C25H22F3NO4 — CID 138967504
[(E)-[(3Z,5E)-5-methyl-6-phenyl-3-prop-2-enoxycarbonylhexa-3,5-dien-2-ylidene]amino] 4-(trifluoromethyl)benzoate (PubChem CID 138967504) has the molecular formula C25H22F3NO4 and a molecular weight of 457.45 g/mol. Its IUPAC name is [(E)-[(3Z,5E)-5-methyl-6-phenyl-3-prop-2-enoxycarbonylhexa-3,5-dien-2-ylidene]amino] 4-(trifluoromethyl)benzoate.
| Compound Name | [(E)-[(3Z,5E)-5-methyl-6-phenyl-3-prop-2-enoxycarbonylhexa-3,5-dien-2-ylidene]amino] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 138967504 |
| Molecular Formula | C25H22F3NO4 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [(E)-[(3Z,5E)-5-methyl-6-phenyl-3-prop-2-enoxycarbonylhexa-3,5-dien-2-ylidene]amino] 4-(trifluoromethyl)benzoate |
| SMILES | C=CCOC(=O)C(=C\C(C)=C\c1ccccc1)/C(C)=N/OC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H22F3NO4/c1-4-14-32-24(31)22(16-17(2)15-19-8-6-5-7-9-19)18(3)29-33-23(30)20-10-12-21(13-11-20)25(26,27)28/h4-13,15-16H,1,14H2,2-3H3/b17-15+,22-16-,29-18+ |
| InChIKey | PXTJPRXHLSAXRF-DCJHBVQXSA-N |
| XLogP | 6.00 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|