C8H13NO — CID 138967563
(2S,3S)-2-ethyl-4-azaspiro[2.4]heptan-5-one (PubChem CID 138967563) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (2S,3S)-2-ethyl-4-azaspiro[2.4]heptan-5-one.
| Compound Name | (2S,3S)-2-ethyl-4-azaspiro[2.4]heptan-5-one |
|---|---|
| PubChem CID | 138967563 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2S,3S)-2-ethyl-4-azaspiro[2.4]heptan-5-one |
| SMILES | CC[C@H]1C[C@@]12CCC(=O)N2 |
| InChI | InChI=1S/C8H13NO/c1-2-6-5-8(6)4-3-7(10)9-8/h6H,2-5H2,1H3,(H,9,10)/t6-,8-/m0/s1 |
| InChIKey | VYXZNPOYGUYZQL-XPUUQOCRSA-N |
| XLogP | 1.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |