C14H22O5 — CID 138967632
ethyl (E)-4-[(4R,5S)-5-(1-hydroxyprop-2-enyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate (PubChem CID 138967632) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is ethyl (E)-4-[(4R,5S)-5-(1-hydroxyprop-2-enyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate.
| Compound Name | ethyl (E)-4-[(4R,5S)-5-(1-hydroxyprop-2-enyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 138967632 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | ethyl (E)-4-[(4R,5S)-5-(1-hydroxyprop-2-enyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate |
| SMILES | C=CC(O)[C@@H]1OC(C)(C)O[C@@H]1C/C=C/C(=O)OCC |
| InChI | InChI=1S/C14H22O5/c1-5-10(15)13-11(18-14(3,4)19-13)8-7-9-12(16)17-6-2/h5,7,9-11,13,15H,1,6,8H2,2-4H3/b9-7+/t10?,11-,13+/m1/s1 |
| InChIKey | XDDVWXGABKCQDD-XWKRLUCLSA-N |
| XLogP | 1.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|