C14H22O5 — CID 138967658
ethyl 2-[(3aS,4R,6R,7aS)-4-ethenyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]acetate (PubChem CID 138967658) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is ethyl 2-[(3aS,4R,6R,7aS)-4-ethenyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]acetate.
| Compound Name | ethyl 2-[(3aS,4R,6R,7aS)-4-ethenyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 138967658 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | ethyl 2-[(3aS,4R,6R,7aS)-4-ethenyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]acetate |
| SMILES | C=C[C@H]1O[C@@H](CC(=O)OCC)C[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H22O5/c1-5-10-13-11(18-14(3,4)19-13)7-9(17-10)8-12(15)16-6-2/h5,9-11,13H,1,6-8H2,2-4H3/t9-,10-,11+,13-/m1/s1 |
| InChIKey | DIGJLGDDBWOVNL-HNCHTBHHSA-N |
| XLogP | 1.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|