C27H56O6Si — CID 138967740
[(4R,5S)-5-[(2R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tridecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 138967740) has the molecular formula C27H56O6Si and a molecular weight of 504.83 g/mol. Its IUPAC name is [(4R,5S)-5-[(2R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tridecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5S)-5-[(2R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tridecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 138967740 |
| Molecular Formula | C27H56O6Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.38 |
| IUPAC Name | [(4R,5S)-5-[(2R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)tridecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CCCCC[C@H](CCCCC[C@H](C[C@@H]1OC(C)(C)O[C@@H]1CO)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O6Si/c1-10-11-13-16-22(33-34(8,9)26(2,3)4)17-14-12-15-18-23(30-21-29-7)19-24-25(20-28)32-27(5,6)31-24/h22-25,28H,10-21H2,1-9H3/t22-,23-,24+,25-/m1/s1 |
| InChIKey | NYSIOKNUPMOXNQ-ZKGSSEMHSA-N |
| XLogP | 6.80 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|