C26H22N2O2 — CID 138967861
2,9-bis(4-methoxyphenyl)-10a,10b-dihydro-1,10-phenanthroline (PubChem CID 138967861) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2,9-bis(4-methoxyphenyl)-10a,10b-dihydro-1,10-phenanthroline.
| Compound Name | 2,9-bis(4-methoxyphenyl)-10a,10b-dihydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 138967861 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2,9-bis(4-methoxyphenyl)-10a,10b-dihydro-1,10-phenanthroline |
| SMILES | COc1ccc(C2=NC3C(=CC=C4C=CC(c5ccc(OC)cc5)=NC43)C=C2)cc1 |
| InChI | InChI=1S/C26H22N2O2/c1-29-21-11-5-17(6-12-21)23-15-9-19-3-4-20-10-16-24(28-26(20)25(19)27-23)18-7-13-22(30-2)14-8-18/h3-16,25-26H,1-2H3 |
| InChIKey | JJGNHKXZTLGGON-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |