About N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide
N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide (PubChem CID 138967907) has the molecular formula C22H20INO3S
and a molecular weight of 505.38 g/mol. Its IUPAC name is N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide |
| PubChem CID | 138967907 |
| Molecular Formula | C22H20INO3S |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C(=O)c2ccccc2)C(I)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20INO3S/c1-16-12-14-19(15-13-16)28(26,27)24-21(20(23)17-8-4-2-5-9-17)22(25)18-10-6-3-7-11-18/h2-15,20-21,24H,1H3 |
| InChIKey | DXLSIPWVJVCEOH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide?
The IUPAC name of N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide (CID 138967907) is N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide.
What is the SMILES notation for N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide?
The canonical SMILES for N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)NC(C(=O)c2ccccc2)C(I)c2ccccc2)cc1.
What is the InChIKey of N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide?
The InChIKey is DXLSIPWVJVCEOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20INO3S/c1-16-12-14-19(15-13-16)28(26,27)24-21(20(23)17-8-4-2-5-9-17)22(25)18-10-6-3-7-11-18/h2-15,20-21,24H,1H3.
What are the key properties of N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide?
N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide has a molecular weight of 505.38 g/mol, XLogP of 4.70, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-iodo-3-oxo-1,3-diphenylpropan-2-yl)-4-methylbenzenesulfonamide is sourced from PubChem (CID 138967907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).