C27H22F3NO4 — CID 138968001
[(E)-[(E)-3-ethoxycarbonyl-4-(4-phenylphenyl)but-3-en-2-ylidene]amino] 4-(trifluoromethyl)benzoate (PubChem CID 138968001) has the molecular formula C27H22F3NO4 and a molecular weight of 481.47 g/mol. Its IUPAC name is [(E)-[(E)-3-ethoxycarbonyl-4-(4-phenylphenyl)but-3-en-2-ylidene]amino] 4-(trifluoromethyl)benzoate.
| Compound Name | [(E)-[(E)-3-ethoxycarbonyl-4-(4-phenylphenyl)but-3-en-2-ylidene]amino] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 138968001 |
| Molecular Formula | C27H22F3NO4 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | [(E)-[(E)-3-ethoxycarbonyl-4-(4-phenylphenyl)but-3-en-2-ylidene]amino] 4-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)C(=C/c1ccc(-c2ccccc2)cc1)/C(C)=N/OC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H22F3NO4/c1-3-34-26(33)24(17-19-9-11-21(12-10-19)20-7-5-4-6-8-20)18(2)31-35-25(32)22-13-15-23(16-14-22)27(28,29)30/h4-17H,3H2,1-2H3/b24-17+,31-18+ |
| InChIKey | SOSCHJAEEKSMSC-UGWJVXAQSA-N |
| XLogP | 6.55 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|