C25H32N4O4 — CID 138968164
3-(4-nitrophenyl)-1-phenyl-4-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]imidazolidin-2-one (PubChem CID 138968164) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1-phenyl-4-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]imidazolidin-2-one.
| Compound Name | 3-(4-nitrophenyl)-1-phenyl-4-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 138968164 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 3-(4-nitrophenyl)-1-phenyl-4-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]imidazolidin-2-one |
| SMILES | CC1(C)CCCC(C)(C)N1OCC1CN(c2ccccc2)C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H32N4O4/c1-24(2)15-8-16-25(3,4)29(24)33-18-22-17-26(19-9-6-5-7-10-19)23(30)27(22)20-11-13-21(14-12-20)28(31)32/h5-7,9-14,22H,8,15-18H2,1-4H3 |
| InChIKey | YGHXKYUCHJMBTJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|