C21H36O2Si — CID 138968524
(3R,4E,6Z,9Z,12Z)-3-[tert-butyl(dimethyl)silyl]oxypentadeca-4,6,9,12-tetraenal (PubChem CID 138968524) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (3R,4E,6Z,9Z,12Z)-3-[tert-butyl(dimethyl)silyl]oxypentadeca-4,6,9,12-tetraenal.
| Compound Name | (3R,4E,6Z,9Z,12Z)-3-[tert-butyl(dimethyl)silyl]oxypentadeca-4,6,9,12-tetraenal |
|---|---|
| PubChem CID | 138968524 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (3R,4E,6Z,9Z,12Z)-3-[tert-butyl(dimethyl)silyl]oxypentadeca-4,6,9,12-tetraenal |
| SMILES | CC/C=C\C/C=C\C/C=C\C=C\[C@@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-20(18-19-22)23-24(5,6)21(2,3)4/h8-9,11-12,14-17,19-20H,7,10,13,18H2,1-6H3/b9-8-,12-11-,15-14-,17-16+/t20-/m0/s1 |
| InChIKey | RGBZNVQIVUXDNT-NNVJIEGUSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|