About 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol
3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol (PubChem CID 138968633) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol.
Molecular Properties
| Compound Name | 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol |
| PubChem CID | 138968633 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol |
| SMILES | C=C1C[C@H]2C=C[C@H](O2)[C@H]1OCCCO |
| InChI | InChI=1S/C11H16O3/c1-8-7-9-3-4-10(14-9)11(8)13-6-2-5-12/h3-4,9-12H,1-2,5-7H2/t9-,10+,11+/m1/s1 |
| InChIKey | CZIFTDJZMYUYDM-VWYCJHECSA-N |
| XLogP | 1.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol?
The IUPAC name of 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol (CID 138968633) is 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol.
What is the SMILES notation for 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol?
The canonical SMILES for 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol is C=C1C[C@H]2C=C[C@H](O2)[C@H]1OCCCO.
What is the InChIKey of 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol?
The InChIKey is CZIFTDJZMYUYDM-VWYCJHECSA-N. The full InChI is InChI=1S/C11H16O3/c1-8-7-9-3-4-10(14-9)11(8)13-6-2-5-12/h3-4,9-12H,1-2,5-7H2/t9-,10+,11+/m1/s1.
What are the key properties of 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol?
3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol has a molecular weight of 196.25 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1S,2S,5S)-3-methylidene-8-oxabicyclo[3.2.1]oct-6-en-2-yl]oxy]propan-1-ol is sourced from PubChem (CID 138968633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).