C24H46O3Si2 — CID 138968661
(2E,4S,6Z,9Z)-4,12-bis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,6,9-trienal (PubChem CID 138968661) has the molecular formula C24H46O3Si2 and a molecular weight of 438.80 g/mol. Its IUPAC name is (2E,4S,6Z,9Z)-4,12-bis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,6,9-trienal.
| Compound Name | (2E,4S,6Z,9Z)-4,12-bis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,6,9-trienal |
|---|---|
| PubChem CID | 138968661 |
| Molecular Formula | C24H46O3Si2 |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (2E,4S,6Z,9Z)-4,12-bis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,6,9-trienal |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C=C\C/C=C\C[C@@H](/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O3Si2/c1-23(2,3)28(7,8)26-21-16-14-12-11-13-15-18-22(19-17-20-25)27-29(9,10)24(4,5)6/h12-15,17,19-20,22H,11,16,18,21H2,1-10H3/b14-12-,15-13-,19-17+/t22-/m0/s1 |
| InChIKey | MJXGTOGJTWKURK-AXYABNDJSA-N |
| XLogP | 7.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|