C34H22N2O3 — CID 138968817
10-methyl-2-phenylspiro[10,13-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,15,17,19-octaene-14,3'-2H-naphthalene]-1',4',12-trione (PubChem CID 138968817) has the molecular formula C34H22N2O3 and a molecular weight of 506.56 g/mol. Its IUPAC name is 10-methyl-2-phenylspiro[10,13-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,15,17,19-octaene-14,3'-2H-naphthalene]-1',4',12-trione.
| Compound Name | 10-methyl-2-phenylspiro[10,13-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,15,17,19-octaene-14,3'-2H-naphthalene]-1',4',12-trione |
|---|---|
| PubChem CID | 138968817 |
| Molecular Formula | C34H22N2O3 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 10-methyl-2-phenylspiro[10,13-diazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,15,17,19-octaene-14,3'-2H-naphthalene]-1',4',12-trione |
| SMILES | Cn1c2ccccc2c2c(-c3ccccc3)c3n(c(=O)c21)C1(CC(=O)c2ccccc2C1=O)c1ccccc1-3 |
| InChI | InChI=1S/C34H22N2O3/c1-35-26-18-10-8-16-24(26)29-28(20-11-3-2-4-12-20)30-23-15-7-9-17-25(23)34(36(30)33(39)31(29)35)19-27(37)21-13-5-6-14-22(21)32(34)38/h2-18H,19H2,1H3 |
| InChIKey | AUDXRSWEKXLAHB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|