C18H34O2Si — CID 138968865
(3aR,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,4,5,6,7,8,9,9a-octahydrocyclopenta[8]annulen-3a-ol (PubChem CID 138968865) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is (3aR,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,4,5,6,7,8,9,9a-octahydrocyclopenta[8]annulen-3a-ol.
| Compound Name | (3aR,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,4,5,6,7,8,9,9a-octahydrocyclopenta[8]annulen-3a-ol |
|---|---|
| PubChem CID | 138968865 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (3aR,9aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,4,5,6,7,8,9,9a-octahydrocyclopenta[8]annulen-3a-ol |
| SMILES | CC1=CC(O[Si](C)(C)C(C)(C)C)[C@@H]2CCCCCC[C@]12O |
| InChI | InChI=1S/C18H34O2Si/c1-14-13-16(20-21(5,6)17(2,3)4)15-11-9-7-8-10-12-18(14,15)19/h13,15-16,19H,7-12H2,1-6H3/t15-,16?,18-/m0/s1 |
| InChIKey | RKLFQVYRXPYMBV-SPQDMEGHSA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|