C22H42O2Si — CID 138968866
(3aR,13aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,4,5,6,7,8,9,10,11,12,13,13a-dodecahydrocyclopenta[12]annulen-3a-ol (PubChem CID 138968866) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is (3aR,13aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,4,5,6,7,8,9,10,11,12,13,13a-dodecahydrocyclopenta[12]annulen-3a-ol.
| Compound Name | (3aR,13aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,4,5,6,7,8,9,10,11,12,13,13a-dodecahydrocyclopenta[12]annulen-3a-ol |
|---|---|
| PubChem CID | 138968866 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (3aR,13aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,4,5,6,7,8,9,10,11,12,13,13a-dodecahydrocyclopenta[12]annulen-3a-ol |
| SMILES | CC1=CC(O[Si](C)(C)C(C)(C)C)[C@@H]2CCCCCCCCCC[C@]12O |
| InChI | InChI=1S/C22H42O2Si/c1-18-17-20(24-25(5,6)21(2,3)4)19-15-13-11-9-7-8-10-12-14-16-22(18,19)23/h17,19-20,23H,7-16H2,1-6H3/t19-,20?,22-/m0/s1 |
| InChIKey | DTPDYYLKIFFJKL-DJJOMLBWSA-N |
| XLogP | 6.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|