C22H26BN3O4 — CID 138968894
(1R,10S)-10-methyl-11-methylidene-4-phenyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 138968894) has the molecular formula C22H26BN3O4 and a molecular weight of 407.28 g/mol. Its IUPAC name is (1R,10S)-10-methyl-11-methylidene-4-phenyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,10S)-10-methyl-11-methylidene-4-phenyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 138968894 |
| Molecular Formula | C22H26BN3O4 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (1R,10S)-10-methyl-11-methylidene-4-phenyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | C=C1C2C=C[C@@H](n3c(=O)n(-c4ccccc4)c(=O)n32)[C@]1(C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H26BN3O4/c1-14-16-12-13-17(22(14,6)23-29-20(2,3)21(4,5)30-23)26-19(28)24(18(27)25(16)26)15-10-8-7-9-11-15/h7-13,16-17H,1H2,2-6H3/t16?,17-,22-/m1/s1 |
| InChIKey | VBSMPXQDCMGTGC-UVMRWNARSA-N |
| XLogP | 2.88 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|