About 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one
3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one (PubChem CID 138969081) has the molecular formula C14H15F3O3
and a molecular weight of 288.26 g/mol. Its IUPAC name is 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one |
| PubChem CID | 138969081 |
| Molecular Formula | C14H15F3O3 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one |
| SMILES | Cc1ccc([C@](O)(CC2=CC(=O)CCC2)C(F)(F)F)o1 |
| InChI | InChI=1S/C14H15F3O3/c1-9-5-6-12(20-9)13(19,14(15,16)17)8-10-3-2-4-11(18)7-10/h5-7,19H,2-4,8H2,1H3/t13-/m1/s1 |
| InChIKey | VMALNXBQQVPRNO-CYBMUJFWSA-N |
| XLogP | 3.41 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one?
The IUPAC name of 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one (CID 138969081) is 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one.
What is the SMILES notation for 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one?
The canonical SMILES for 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one is Cc1ccc([C@](O)(CC2=CC(=O)CCC2)C(F)(F)F)o1.
What is the InChIKey of 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one?
The InChIKey is VMALNXBQQVPRNO-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H15F3O3/c1-9-5-6-12(20-9)13(19,14(15,16)17)8-10-3-2-4-11(18)7-10/h5-7,19H,2-4,8H2,1H3/t13-/m1/s1.
What are the key properties of 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one?
3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one has a molecular weight of 288.26 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R)-3,3,3-trifluoro-2-hydroxy-2-(5-methylfuran-2-yl)propyl]cyclohex-2-en-1-one is sourced from PubChem (CID 138969081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).