About (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate
(1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate (PubChem CID 138969217) has the molecular formula C13H11NO5
and a molecular weight of 261.23 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate.
Molecular Properties
| Compound Name | (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate |
| PubChem CID | 138969217 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate |
| SMILES | O=C(ON1C(=O)c2ccccc2C1=O)C1CCCO1 |
| InChI | InChI=1S/C13H11NO5/c15-11-8-4-1-2-5-9(8)12(16)14(11)19-13(17)10-6-3-7-18-10/h1-2,4-5,10H,3,6-7H2 |
| InChIKey | HMQLJJPUSZLJTE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate?
The IUPAC name of (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate (CID 138969217) is (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate is O=C(ON1C(=O)c2ccccc2C1=O)C1CCCO1.
What is the InChIKey of (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate?
The InChIKey is HMQLJJPUSZLJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO5/c15-11-8-4-1-2-5-9(8)12(16)14(11)19-13(17)10-6-3-7-18-10/h1-2,4-5,10H,3,6-7H2.
What are the key properties of (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate?
(1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate has a molecular weight of 261.23 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl) oxolane-2-carboxylate is sourced from PubChem (CID 138969217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).