C17H13N3O — CID 138969242
7-(furan-2-yl)-5-(3-methylphenyl)imidazo[1,2-a]pyrimidine (PubChem CID 138969242) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is 7-(furan-2-yl)-5-(3-methylphenyl)imidazo[1,2-a]pyrimidine.
| Compound Name | 7-(furan-2-yl)-5-(3-methylphenyl)imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 138969242 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 7-(furan-2-yl)-5-(3-methylphenyl)imidazo[1,2-a]pyrimidine |
| SMILES | Cc1cccc(-c2cc(-c3ccco3)nc3nccn23)c1 |
| InChI | InChI=1S/C17H13N3O/c1-12-4-2-5-13(10-12)15-11-14(16-6-3-9-21-16)19-17-18-7-8-20(15)17/h2-11H,1H3 |
| InChIKey | UAELDNSEJAGCHR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |