C25H40N2O — CID 138969258
(5Z,8Z,11Z,14Z,17Z)-1-(4-methylpiperazin-1-yl)icosa-5,8,11,14,17-pentaen-1-one (PubChem CID 138969258) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-1-(4-methylpiperazin-1-yl)icosa-5,8,11,14,17-pentaen-1-one.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-1-(4-methylpiperazin-1-yl)icosa-5,8,11,14,17-pentaen-1-one |
|---|---|
| PubChem CID | 138969258 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-1-(4-methylpiperazin-1-yl)icosa-5,8,11,14,17-pentaen-1-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C25H40N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(28)27-23-21-26(2)22-24-27/h4-5,7-8,10-11,13-14,16-17H,3,6,9,12,15,18-24H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | OQJIZBSUYRNTRW-JEBPEJKESA-N |
| XLogP | 5.68 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|