C9H16O — CID 138969313
(4R,6R)-6-methylocta-1,7-dien-4-ol (PubChem CID 138969313) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (4R,6R)-6-methylocta-1,7-dien-4-ol.
| Compound Name | (4R,6R)-6-methylocta-1,7-dien-4-ol |
|---|---|
| PubChem CID | 138969313 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (4R,6R)-6-methylocta-1,7-dien-4-ol |
| SMILES | C=CC[C@@H](O)C[C@@H](C)C=C |
| InChI | InChI=1S/C9H16O/c1-4-6-9(10)7-8(3)5-2/h4-5,8-10H,1-2,6-7H2,3H3/t8-,9+/m0/s1 |
| InChIKey | WBPPOAADZUMIFR-DTWKUNHWSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|