C32H24F3NO3S — CID 138969332
N-[(1R)-6-methoxy-3-(2-phenylethynyl)-1-[4-(trifluoromethyl)phenyl]-1H-inden-2-yl]-4-methylbenzenesulfonamide (PubChem CID 138969332) has the molecular formula C32H24F3NO3S and a molecular weight of 559.61 g/mol. Its IUPAC name is N-[(1R)-6-methoxy-3-(2-phenylethynyl)-1-[4-(trifluoromethyl)phenyl]-1H-inden-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-6-methoxy-3-(2-phenylethynyl)-1-[4-(trifluoromethyl)phenyl]-1H-inden-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 138969332 |
| Molecular Formula | C32H24F3NO3S |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | N-[(1R)-6-methoxy-3-(2-phenylethynyl)-1-[4-(trifluoromethyl)phenyl]-1H-inden-2-yl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc2c(c1)[C@@H](c1ccc(C(F)(F)F)cc1)C(NS(=O)(=O)c1ccc(C)cc1)=C2C#Cc1ccccc1 |
| InChI | InChI=1S/C32H24F3NO3S/c1-21-8-16-26(17-9-21)40(37,38)36-31-28(18-10-22-6-4-3-5-7-22)27-19-15-25(39-2)20-29(27)30(31)23-11-13-24(14-12-23)32(33,34)35/h3-9,11-17,19-20,30,36H,1-2H3/t30-/m1/s1 |
| InChIKey | RQFQADQSPHDFNY-SSEXGKCCSA-N |
| XLogP | 6.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|