C27H27F3O4S — CID 138969443
[(8S,9S,13S,14S)-17-(4-acetylphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate (PubChem CID 138969443) has the molecular formula C27H27F3O4S and a molecular weight of 504.57 g/mol. Its IUPAC name is [(8S,9S,13S,14S)-17-(4-acetylphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate.
| Compound Name | [(8S,9S,13S,14S)-17-(4-acetylphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138969443 |
| Molecular Formula | C27H27F3O4S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | [(8S,9S,13S,14S)-17-(4-acetylphenyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
| SMILES | CC(=O)c1ccc(C2=CC[C@H]3[C@@H]4CCc5cc(OS(=O)(=O)C(F)(F)F)ccc5[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C27H27F3O4S/c1-16(31)17-3-5-18(6-4-17)24-11-12-25-23-9-7-19-15-20(34-35(32,33)27(28,29)30)8-10-21(19)22(23)13-14-26(24,25)2/h3-6,8,10-11,15,22-23,25H,7,9,12-14H2,1-2H3/t22-,23-,25+,26-/m1/s1 |
| InChIKey | AATQTMYXMQTNLG-VHCQPULKSA-N |
| XLogP | 6.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|