C26H40N2O5Si — CID 138969609
prop-2-enyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-[1-[2-[(2R)-oxiran-2-yl]propan-2-yl]indol-3-yl]propan-2-yl]carbamate (PubChem CID 138969609) has the molecular formula C26H40N2O5Si and a molecular weight of 488.70 g/mol. Its IUPAC name is prop-2-enyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-[1-[2-[(2R)-oxiran-2-yl]propan-2-yl]indol-3-yl]propan-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-[1-[2-[(2R)-oxiran-2-yl]propan-2-yl]indol-3-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 138969609 |
| Molecular Formula | C26H40N2O5Si |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | prop-2-enyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1-[1-[2-[(2R)-oxiran-2-yl]propan-2-yl]indol-3-yl]propan-2-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)c1cn(C(C)(C)[C@@H]2CO2)c2ccccc12 |
| InChI | InChI=1S/C26H40N2O5Si/c1-9-14-31-24(30)27-20(16-33-34(7,8)25(2,3)4)23(29)19-15-28(26(5,6)22-17-32-22)21-13-11-10-12-18(19)21/h9-13,15,20,22-23,29H,1,14,16-17H2,2-8H3,(H,27,30)/t20-,22+,23-/m1/s1 |
| InChIKey | OKZAOTSYIFJVKU-AKIFATBCSA-N |
| XLogP | 5.11 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|