About (3-fluorophenyl) N,N-dimethylcarbamodithioate
(3-fluorophenyl) N,N-dimethylcarbamodithioate (PubChem CID 138969679) has the molecular formula C9H10FNS2
and a molecular weight of 215.32 g/mol. Its IUPAC name is (3-fluorophenyl) N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | (3-fluorophenyl) N,N-dimethylcarbamodithioate |
| PubChem CID | 138969679 |
| Molecular Formula | C9H10FNS2 |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | (3-fluorophenyl) N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)Sc1cccc(F)c1 |
| InChI | InChI=1S/C9H10FNS2/c1-11(2)9(12)13-8-5-3-4-7(10)6-8/h3-6H,1-2H3 |
| InChIKey | OIKKFWYCUCSOGF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-fluorophenyl) N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl) N,N-dimethylcarbamodithioate?
The IUPAC name of (3-fluorophenyl) N,N-dimethylcarbamodithioate (CID 138969679) is (3-fluorophenyl) N,N-dimethylcarbamodithioate.
What is the SMILES notation for (3-fluorophenyl) N,N-dimethylcarbamodithioate?
The canonical SMILES for (3-fluorophenyl) N,N-dimethylcarbamodithioate is CN(C)C(=S)Sc1cccc(F)c1.
What is the InChIKey of (3-fluorophenyl) N,N-dimethylcarbamodithioate?
The InChIKey is OIKKFWYCUCSOGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNS2/c1-11(2)9(12)13-8-5-3-4-7(10)6-8/h3-6H,1-2H3.
What are the key properties of (3-fluorophenyl) N,N-dimethylcarbamodithioate?
(3-fluorophenyl) N,N-dimethylcarbamodithioate has a molecular weight of 215.32 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl) N,N-dimethylcarbamodithioate is sourced from PubChem (CID 138969679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).