C15H14F9NO4S — CID 138969800
[5-(diethylamino)-2-formylphenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 138969800) has the molecular formula C15H14F9NO4S and a molecular weight of 475.33 g/mol. Its IUPAC name is [5-(diethylamino)-2-formylphenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [5-(diethylamino)-2-formylphenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 138969800 |
| Molecular Formula | C15H14F9NO4S |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | [5-(diethylamino)-2-formylphenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCN(CC)c1ccc(C=O)c(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F9NO4S/c1-3-25(4-2)10-6-5-9(8-26)11(7-10)29-30(27,28)15(23,24)13(18,19)12(16,17)14(20,21)22/h5-8H,3-4H2,1-2H3 |
| InChIKey | IHDYIMILLAMKOL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|