C20H33NO4 — CID 138970016
ditert-butyl (2S,4R,5S)-4,5-bis(prop-2-enyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 138970016) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is ditert-butyl (2S,4R,5S)-4,5-bis(prop-2-enyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4R,5S)-4,5-bis(prop-2-enyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 138970016 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | ditert-butyl (2S,4R,5S)-4,5-bis(prop-2-enyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@@H]1C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1CC=C |
| InChI | InChI=1S/C20H33NO4/c1-9-11-14-13-16(17(22)24-19(3,4)5)21(15(14)12-10-2)18(23)25-20(6,7)8/h9-10,14-16H,1-2,11-13H2,3-8H3/t14-,15+,16+/m1/s1 |
| InChIKey | KYGVVHZFSRPZFS-PMPSAXMXSA-N |
| XLogP | 4.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|