C18H31NO5 — CID 138970017
ditert-butyl (2S,4R)-5-methoxy-4-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 138970017) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is ditert-butyl (2S,4R)-5-methoxy-4-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4R)-5-methoxy-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 138970017 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | ditert-butyl (2S,4R)-5-methoxy-4-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@@H]1C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1OC |
| InChI | InChI=1S/C18H31NO5/c1-9-10-12-11-13(15(20)23-17(2,3)4)19(14(12)22-8)16(21)24-18(5,6)7/h9,12-14H,1,10-11H2,2-8H3/t12-,13+,14?/m1/s1 |
| InChIKey | YHEMFWVKHIFXDC-AMIUJLCOSA-N |
| XLogP | 3.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|