C30H39NO2SSi — CID 138970059
triethyl-[(Z,1R,2R)-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-1,2-diphenylbut-3-enoxy]silane (PubChem CID 138970059) has the molecular formula C30H39NO2SSi and a molecular weight of 505.80 g/mol. Its IUPAC name is triethyl-[(Z,1R,2R)-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-1,2-diphenylbut-3-enoxy]silane.
| Compound Name | triethyl-[(Z,1R,2R)-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-1,2-diphenylbut-3-enoxy]silane |
|---|---|
| PubChem CID | 138970059 |
| Molecular Formula | C30H39NO2SSi |
| Molecular Weight | 505.80 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | triethyl-[(Z,1R,2R)-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-1,2-diphenylbut-3-enoxy]silane |
| SMILES | CC[Si](CC)(CC)O[C@@H](c1ccccc1)[C@@H](/C(C)=C\[S@@](=O)(=NC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H39NO2SSi/c1-6-35(7-2,8-3)33-30(27-20-14-10-15-21-27)29(26-18-12-9-13-19-26)25(4)24-34(32,31-5)28-22-16-11-17-23-28/h9-24,29-30H,6-8H2,1-5H3/b25-24-/t29-,30-,34-/m0/s1 |
| InChIKey | DOOHNAOVTGQXHO-SMUAOITRSA-N |
| XLogP | 8.59 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.80 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|