C25H43NO2Si — CID 138970075
N-[1-phenyl-3-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexanecarboxamide (PubChem CID 138970075) has the molecular formula C25H43NO2Si and a molecular weight of 417.71 g/mol. Its IUPAC name is N-[1-phenyl-3-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-phenyl-3-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 138970075 |
| Molecular Formula | C25H43NO2Si |
| Molecular Weight | 417.71 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | N-[1-phenyl-3-tri(propan-2-yl)silyloxypropan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(C)[Si](OCC(Cc1ccccc1)NC(=O)C1CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H43NO2Si/c1-19(2)29(20(3)4,21(5)6)28-18-24(17-22-13-9-7-10-14-22)26-25(27)23-15-11-8-12-16-23/h7,9-10,13-14,19-21,23-24H,8,11-12,15-18H2,1-6H3,(H,26,27) |
| InChIKey | VJNKVTFOEMKKQT-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|