About CID 138970170
CID 138970170 (PubChem CID 138970170) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol.
Molecular Properties
| Compound Name | CID 138970170 |
| PubChem CID | 138970170 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | — |
| SMILES | CC[C@]12CC3(CC3)C(=O)N1C1(CCCCC1)CO2 |
| InChI | InChI=1S/C15H23NO2/c1-2-15-10-13(8-9-13)12(17)16(15)14(11-18-15)6-4-3-5-7-14/h2-11H2,1H3/t15-/m0/s1 |
| InChIKey | LJEPEOAQLJNRGW-HNNXBMFYSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 138970170 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138970170?
The IUPAC name of CID 138970170 (CID 138970170) is not available.
What is the SMILES notation for CID 138970170?
The canonical SMILES for CID 138970170 is CC[C@]12CC3(CC3)C(=O)N1C1(CCCCC1)CO2.
What is the InChIKey of CID 138970170?
The InChIKey is LJEPEOAQLJNRGW-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-2-15-10-13(8-9-13)12(17)16(15)14(11-18-15)6-4-3-5-7-14/h2-11H2,1H3/t15-/m0/s1.
What are the key properties of CID 138970170?
CID 138970170 has a molecular weight of 249.35 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138970170 is sourced from PubChem (CID 138970170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).