C14H15FO — CID 138970180
(2S,10aS)-6-fluoro-1,2,3,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 138970180) has the molecular formula C14H15FO and a molecular weight of 218.27 g/mol. Its IUPAC name is (2S,10aS)-6-fluoro-1,2,3,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2S,10aS)-6-fluoro-1,2,3,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 138970180 |
| Molecular Formula | C14H15FO |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (2S,10aS)-6-fluoro-1,2,3,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | O[C@H]1CC=C2c3cc(F)ccc3CC[C@H]2C1 |
| InChI | InChI=1S/C14H15FO/c15-11-4-3-9-1-2-10-7-12(16)5-6-13(10)14(9)8-11/h3-4,6,8,10,12,16H,1-2,5,7H2/t10-,12-/m0/s1 |
| InChIKey | VDYSJWWXNVZDJQ-JQWIXIFHSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |