C17H17BrO3 — CID 138970314
(2R,3R,4S)-6-bromo-2,4-dimethoxy-3-phenyl-3,4-dihydro-2H-chromene (PubChem CID 138970314) has the molecular formula C17H17BrO3 and a molecular weight of 349.22 g/mol. Its IUPAC name is (2R,3R,4S)-6-bromo-2,4-dimethoxy-3-phenyl-3,4-dihydro-2H-chromene.
| Compound Name | (2R,3R,4S)-6-bromo-2,4-dimethoxy-3-phenyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 138970314 |
| Molecular Formula | C17H17BrO3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (2R,3R,4S)-6-bromo-2,4-dimethoxy-3-phenyl-3,4-dihydro-2H-chromene |
| SMILES | CO[C@@H]1Oc2ccc(Br)cc2[C@@H](OC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17BrO3/c1-19-16-13-10-12(18)8-9-14(13)21-17(20-2)15(16)11-6-4-3-5-7-11/h3-10,15-17H,1-2H3/t15-,16-,17-/m1/s1 |
| InChIKey | STZJPRXCLUPZHD-BRWVUGGUSA-N |
| XLogP | 4.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |