C35H39N2Pd+ — CID 138970388
(4R,5R)-1,3-bis(2,6-diethylphenyl)-4,5-diphenylimidazolidin-2-ide;palladium(2+) (PubChem CID 138970388) has the molecular formula C35H39N2Pd+ and a molecular weight of 594.13 g/mol. Its IUPAC name is (4R,5R)-1,3-bis(2,6-diethylphenyl)-4,5-diphenylimidazolidin-2-ide;palladium(2+).
| Compound Name | (4R,5R)-1,3-bis(2,6-diethylphenyl)-4,5-diphenylimidazolidin-2-ide;palladium(2+) |
|---|---|
| PubChem CID | 138970388 |
| Molecular Formula | C35H39N2Pd+ |
| Molecular Weight | 594.13 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | (4R,5R)-1,3-bis(2,6-diethylphenyl)-4,5-diphenylimidazolidin-2-ide;palladium(2+) |
| SMILES | CCc1cccc(CC)c1N1[CH-]N(c2c(CC)cccc2CC)[C@H](c2ccccc2)[C@H]1c1ccccc1.[Pd+2] |
| InChI | InChI=1S/C35H39N2.Pd/c1-5-26-21-15-22-27(6-2)32(26)36-25-37(33-28(7-3)23-16-24-29(33)8-4)35(31-19-13-10-14-20-31)34(36)30-17-11-9-12-18-30;/h9-25,34-35H,5-8H2,1-4H3;/q-1;+2/t34-,35-;/m1./s1 |
| InChIKey | VJJOZCKNODUTOC-SWIBWIMJSA-N |
| XLogP | 8.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.13 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|