About CID 138970666
CID 138970666 (PubChem CID 138970666) has the molecular formula C16H30PdSi2-
and a molecular weight of 385.01 g/mol.
Molecular Properties
| Compound Name | CID 138970666 |
| PubChem CID | 138970666 |
| Molecular Formula | C16H30PdSi2- |
| Molecular Weight | 385.01 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | — |
| SMILES | CC(C)(C[Si](C)(C)C)c1[c-]cccc1.C[Si](C)C.[Pd] |
| InChI | InChI=1S/C13H21Si.C3H9Si.Pd/c1-13(2,11-14(3,4)5)12-9-7-6-8-10-12;1-4(2)3;/h6-9H,11H2,1-5H3;1-3H3;/q-1;; |
| InChIKey | JGZQAVBDLMCOPB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.01 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 138970666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138970666?
The IUPAC name of CID 138970666 (CID 138970666) is not available.
What is the SMILES notation for CID 138970666?
The canonical SMILES for CID 138970666 is CC(C)(C[Si](C)(C)C)c1[c-]cccc1.C[Si](C)C.[Pd].
What is the InChIKey of CID 138970666?
The InChIKey is JGZQAVBDLMCOPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21Si.C3H9Si.Pd/c1-13(2,11-14(3,4)5)12-9-7-6-8-10-12;1-4(2)3;/h6-9H,11H2,1-5H3;1-3H3;/q-1;;.
What are the key properties of CID 138970666?
CID 138970666 has a molecular weight of 385.01 g/mol, XLogP of 5.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138970666 is sourced from PubChem (CID 138970666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).