About (6E)-2,6-dimethyldodeca-2,6-dien-10-yne
(6E)-2,6-dimethyldodeca-2,6-dien-10-yne (PubChem CID 138970676) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is (6E)-2,6-dimethyldodeca-2,6-dien-10-yne.
Molecular Properties
| Compound Name | (6E)-2,6-dimethyldodeca-2,6-dien-10-yne |
| PubChem CID | 138970676 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (6E)-2,6-dimethyldodeca-2,6-dien-10-yne |
| SMILES | CC#CCC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H22/c1-5-6-7-8-11-14(4)12-9-10-13(2)3/h10-11H,7-9,12H2,1-4H3/b14-11+ |
| InChIKey | YHLTVVLVKFKXMU-SDNWHVSQSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6E)-2,6-dimethyldodeca-2,6-dien-10-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-2,6-dimethyldodeca-2,6-dien-10-yne?
The IUPAC name of (6E)-2,6-dimethyldodeca-2,6-dien-10-yne (CID 138970676) is (6E)-2,6-dimethyldodeca-2,6-dien-10-yne.
What is the SMILES notation for (6E)-2,6-dimethyldodeca-2,6-dien-10-yne?
The canonical SMILES for (6E)-2,6-dimethyldodeca-2,6-dien-10-yne is CC#CCC/C=C(\C)CCC=C(C)C.
What is the InChIKey of (6E)-2,6-dimethyldodeca-2,6-dien-10-yne?
The InChIKey is YHLTVVLVKFKXMU-SDNWHVSQSA-N. The full InChI is InChI=1S/C14H22/c1-5-6-7-8-11-14(4)12-9-10-13(2)3/h10-11H,7-9,12H2,1-4H3/b14-11+.
What are the key properties of (6E)-2,6-dimethyldodeca-2,6-dien-10-yne?
(6E)-2,6-dimethyldodeca-2,6-dien-10-yne has a molecular weight of 190.33 g/mol, XLogP of 4.48, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-2,6-dimethyldodeca-2,6-dien-10-yne is sourced from PubChem (CID 138970676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).