C14H21N — CID 138970706
(2S,6S)-3,3,6-trimethyl-2-phenylpiperidine (PubChem CID 138970706) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (2S,6S)-3,3,6-trimethyl-2-phenylpiperidine.
| Compound Name | (2S,6S)-3,3,6-trimethyl-2-phenylpiperidine |
|---|---|
| PubChem CID | 138970706 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (2S,6S)-3,3,6-trimethyl-2-phenylpiperidine |
| SMILES | C[C@H]1CCC(C)(C)[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C14H21N/c1-11-9-10-14(2,3)13(15-11)12-7-5-4-6-8-12/h4-8,11,13,15H,9-10H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | BKLWIBKKUTYRGJ-WCQYABFASA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |