C13H14F3NO — CID 138970792
(5S,6R)-5-methyl-6-phenyl-5-(trifluoromethyl)piperidin-2-one (PubChem CID 138970792) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is (5S,6R)-5-methyl-6-phenyl-5-(trifluoromethyl)piperidin-2-one.
| Compound Name | (5S,6R)-5-methyl-6-phenyl-5-(trifluoromethyl)piperidin-2-one |
|---|---|
| PubChem CID | 138970792 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (5S,6R)-5-methyl-6-phenyl-5-(trifluoromethyl)piperidin-2-one |
| SMILES | C[C@]1(C(F)(F)F)CCC(=O)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H14F3NO/c1-12(13(14,15)16)8-7-10(18)17-11(12)9-5-3-2-4-6-9/h2-6,11H,7-8H2,1H3,(H,17,18)/t11-,12+/m1/s1 |
| InChIKey | QHWXHFRUVFKOBE-NEPJUHHUSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |