C34H38N3+ — CID 138970802
3,6-ditert-butyl-10-phenyl-9-(2,4,6-trimethylpyrimidin-5-yl)acridin-10-ium (PubChem CID 138970802) has the molecular formula C34H38N3+ and a molecular weight of 488.70 g/mol. Its IUPAC name is 3,6-ditert-butyl-10-phenyl-9-(2,4,6-trimethylpyrimidin-5-yl)acridin-10-ium.
| Compound Name | 3,6-ditert-butyl-10-phenyl-9-(2,4,6-trimethylpyrimidin-5-yl)acridin-10-ium |
|---|---|
| PubChem CID | 138970802 |
| Molecular Formula | C34H38N3+ |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 3,6-ditert-butyl-10-phenyl-9-(2,4,6-trimethylpyrimidin-5-yl)acridin-10-ium |
| SMILES | Cc1nc(C)c(-c2c3ccc(C(C)(C)C)cc3[n+](-c3ccccc3)c3cc(C(C)(C)C)ccc23)c(C)n1 |
| InChI | InChI=1S/C34H38N3/c1-21-31(22(2)36-23(3)35-21)32-27-17-15-24(33(4,5)6)19-29(27)37(26-13-11-10-12-14-26)30-20-25(34(7,8)9)16-18-28(30)32/h10-20H,1-9H3/q+1 |
| InChIKey | WQJIUAOPSPXIMA-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|