C27H26N2O5S — CID 138970855
1-[6,7-dimethoxy-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]indole-3-carbaldehyde (PubChem CID 138970855) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is 1-[6,7-dimethoxy-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]indole-3-carbaldehyde.
| Compound Name | 1-[6,7-dimethoxy-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 138970855 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-[6,7-dimethoxy-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-1-yl]indole-3-carbaldehyde |
| SMILES | COc1cc2c(cc1OC)C(n1cc(C=O)c3ccccc31)N(S(=O)(=O)c1ccc(C)cc1)CC2 |
| InChI | InChI=1S/C27H26N2O5S/c1-18-8-10-21(11-9-18)35(31,32)29-13-12-19-14-25(33-2)26(34-3)15-23(19)27(29)28-16-20(17-30)22-6-4-5-7-24(22)28/h4-11,14-17,27H,12-13H2,1-3H3 |
| InChIKey | NMNJDTIHPUIDPU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|