C25H37NO3SSi — CID 138970926
(Z,2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(N-methyl-S-phenylsulfonimidoyl)-3-phenylpent-4-en-2-ol (PubChem CID 138970926) has the molecular formula C25H37NO3SSi and a molecular weight of 459.73 g/mol. Its IUPAC name is (Z,2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(N-methyl-S-phenylsulfonimidoyl)-3-phenylpent-4-en-2-ol.
| Compound Name | (Z,2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(N-methyl-S-phenylsulfonimidoyl)-3-phenylpent-4-en-2-ol |
|---|---|
| PubChem CID | 138970926 |
| Molecular Formula | C25H37NO3SSi |
| Molecular Weight | 459.73 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (Z,2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-(N-methyl-S-phenylsulfonimidoyl)-3-phenylpent-4-en-2-ol |
| SMILES | CN=[S@](=O)(/C=C(/C)[C@@H](c1ccccc1)[C@@H](O)CO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H37NO3SSi/c1-20(19-30(28,26-5)22-16-12-9-13-17-22)24(21-14-10-8-11-15-21)23(27)18-29-31(6,7)25(2,3)4/h8-17,19,23-24,27H,18H2,1-7H3/b20-19-/t23-,24-,30-/m0/s1 |
| InChIKey | AHFMYVSZAOWMBV-LOSZNKIUSA-N |
| XLogP | 6.21 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|