C27H40BrNO2SSi — CID 138970928
[(Z,1R,2R)-1-(4-bromophenyl)-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-2-propan-2-ylbut-3-enoxy]-triethylsilane (PubChem CID 138970928) has the molecular formula C27H40BrNO2SSi and a molecular weight of 550.68 g/mol. Its IUPAC name is [(Z,1R,2R)-1-(4-bromophenyl)-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-2-propan-2-ylbut-3-enoxy]-triethylsilane.
| Compound Name | [(Z,1R,2R)-1-(4-bromophenyl)-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-2-propan-2-ylbut-3-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 138970928 |
| Molecular Formula | C27H40BrNO2SSi |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | [(Z,1R,2R)-1-(4-bromophenyl)-3-methyl-4-(N-methyl-S-phenylsulfonimidoyl)-2-propan-2-ylbut-3-enoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H](c1ccc(Br)cc1)[C@@H](/C(C)=C\[S@@](=O)(=NC)c1ccccc1)C(C)C |
| InChI | InChI=1S/C27H40BrNO2SSi/c1-8-33(9-2,10-3)31-27(23-16-18-24(28)19-17-23)26(21(4)5)22(6)20-32(30,29-7)25-14-12-11-13-15-25/h11-21,26-27H,8-10H2,1-7H3/b22-20-/t26-,27+,32+/m1/s1 |
| InChIKey | GRTQATRJHQLYCH-CRMCRPJDSA-N |
| XLogP | 8.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|