About S-(1,1-diphenylhexyl) N-methylcarbamothioate
S-(1,1-diphenylhexyl) N-methylcarbamothioate (PubChem CID 138970951) has the molecular formula C20H25NOS
and a molecular weight of 327.49 g/mol. Its IUPAC name is S-(1,1-diphenylhexyl) N-methylcarbamothioate.
Molecular Properties
| Compound Name | S-(1,1-diphenylhexyl) N-methylcarbamothioate |
| PubChem CID | 138970951 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | S-(1,1-diphenylhexyl) N-methylcarbamothioate |
| SMILES | CCCCCC(SC(=O)NC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NOS/c1-3-4-11-16-20(23-19(22)21-2,17-12-7-5-8-13-17)18-14-9-6-10-15-18/h5-10,12-15H,3-4,11,16H2,1-2H3,(H,21,22) |
| InChIKey | IRTWSVPEBPGYLZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(1,1-diphenylhexyl) N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1,1-diphenylhexyl) N-methylcarbamothioate?
The IUPAC name of S-(1,1-diphenylhexyl) N-methylcarbamothioate (CID 138970951) is S-(1,1-diphenylhexyl) N-methylcarbamothioate.
What is the SMILES notation for S-(1,1-diphenylhexyl) N-methylcarbamothioate?
The canonical SMILES for S-(1,1-diphenylhexyl) N-methylcarbamothioate is CCCCCC(SC(=O)NC)(c1ccccc1)c1ccccc1.
What is the InChIKey of S-(1,1-diphenylhexyl) N-methylcarbamothioate?
The InChIKey is IRTWSVPEBPGYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NOS/c1-3-4-11-16-20(23-19(22)21-2,17-12-7-5-8-13-17)18-14-9-6-10-15-18/h5-10,12-15H,3-4,11,16H2,1-2H3,(H,21,22).
What are the key properties of S-(1,1-diphenylhexyl) N-methylcarbamothioate?
S-(1,1-diphenylhexyl) N-methylcarbamothioate has a molecular weight of 327.49 g/mol, XLogP of 5.58, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1,1-diphenylhexyl) N-methylcarbamothioate is sourced from PubChem (CID 138970951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).