C16H21NO3 — CID 138970964
ethyl 2-[(3R,5S)-4,4-dimethyl-2-oxo-5-phenylpyrrolidin-3-yl]acetate (PubChem CID 138970964) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethyl 2-[(3R,5S)-4,4-dimethyl-2-oxo-5-phenylpyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(3R,5S)-4,4-dimethyl-2-oxo-5-phenylpyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 138970964 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | ethyl 2-[(3R,5S)-4,4-dimethyl-2-oxo-5-phenylpyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C(=O)N[C@H](c2ccccc2)C1(C)C |
| InChI | InChI=1S/C16H21NO3/c1-4-20-13(18)10-12-15(19)17-14(16(12,2)3)11-8-6-5-7-9-11/h5-9,12,14H,4,10H2,1-3H3,(H,17,19)/t12-,14+/m0/s1 |
| InChIKey | IGRAVBDXEZKFBC-GXTWGEPZSA-N |
| XLogP | 2.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |