About oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate
oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate (PubChem CID 138971003) has the molecular formula C25H27NO3
and a molecular weight of 389.50 g/mol. Its IUPAC name is oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate.
Molecular Properties
| Compound Name | oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate |
| PubChem CID | 138971003 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate |
| SMILES | C=CC(CCCCC)OC(=O)c1c(-c2cccc(C)c2)cc(=O)n2ccccc12 |
| InChI | InChI=1S/C25H27NO3/c1-4-6-7-13-20(5-2)29-25(28)24-21(19-12-10-11-18(3)16-19)17-23(27)26-15-9-8-14-22(24)26/h5,8-12,14-17,20H,2,4,6-7,13H2,1,3H3 |
| InChIKey | FAXBBNQLWPSBSW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate?
The IUPAC name of oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate (CID 138971003) is oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate.
What is the SMILES notation for oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate?
The canonical SMILES for oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate is C=CC(CCCCC)OC(=O)c1c(-c2cccc(C)c2)cc(=O)n2ccccc12.
What is the InChIKey of oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate?
The InChIKey is FAXBBNQLWPSBSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27NO3/c1-4-6-7-13-20(5-2)29-25(28)24-21(19-12-10-11-18(3)16-19)17-23(27)26-15-9-8-14-22(24)26/h5,8-12,14-17,20H,2,4,6-7,13H2,1,3H3.
What are the key properties of oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate?
oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate has a molecular weight of 389.50 g/mol, XLogP of 5.57, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-en-3-yl 2-(3-methylphenyl)-4-oxoquinolizine-1-carboxylate is sourced from PubChem (CID 138971003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).