C12H17NO3 — CID 138971036
(3aR,7aS)-2-methylspiro[3a,4,5,6,7,7a-hexahydroisoindole-3,5'-oxolane]-1,2'-dione (PubChem CID 138971036) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (3aR,7aS)-2-methylspiro[3a,4,5,6,7,7a-hexahydroisoindole-3,5'-oxolane]-1,2'-dione.
| Compound Name | (3aR,7aS)-2-methylspiro[3a,4,5,6,7,7a-hexahydroisoindole-3,5'-oxolane]-1,2'-dione |
|---|---|
| PubChem CID | 138971036 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (3aR,7aS)-2-methylspiro[3a,4,5,6,7,7a-hexahydroisoindole-3,5'-oxolane]-1,2'-dione |
| SMILES | CN1C(=O)[C@H]2CCCC[C@H]2C12CCC(=O)O2 |
| InChI | InChI=1S/C12H17NO3/c1-13-11(15)8-4-2-3-5-9(8)12(13)7-6-10(14)16-12/h8-9H,2-7H2,1H3/t8-,9+,12?/m0/s1 |
| InChIKey | RPTWABPQXARUMV-JIMHFIIXSA-N |
| XLogP | 1.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |