C18H15ClFNO2 — CID 138971282
(2S,11bR)-2-(4-chlorophenyl)-9-fluoro-2,6,7,11b-tetrahydro-1H-[1,3]oxazino[4,3-a]isoquinolin-4-one (PubChem CID 138971282) has the molecular formula C18H15ClFNO2 and a molecular weight of 331.77 g/mol. Its IUPAC name is (2S,11bR)-2-(4-chlorophenyl)-9-fluoro-2,6,7,11b-tetrahydro-1H-[1,3]oxazino[4,3-a]isoquinolin-4-one.
| Compound Name | (2S,11bR)-2-(4-chlorophenyl)-9-fluoro-2,6,7,11b-tetrahydro-1H-[1,3]oxazino[4,3-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 138971282 |
| Molecular Formula | C18H15ClFNO2 |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (2S,11bR)-2-(4-chlorophenyl)-9-fluoro-2,6,7,11b-tetrahydro-1H-[1,3]oxazino[4,3-a]isoquinolin-4-one |
| SMILES | O=C1O[C@H](c2ccc(Cl)cc2)C[C@@H]2c3ccc(F)cc3CCN12 |
| InChI | InChI=1S/C18H15ClFNO2/c19-13-3-1-11(2-4-13)17-10-16-15-6-5-14(20)9-12(15)7-8-21(16)18(22)23-17/h1-6,9,16-17H,7-8,10H2/t16-,17+/m1/s1 |
| InChIKey | JUVDPXKMHYWTDQ-SJORKVTESA-N |
| XLogP | 4.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |