C22H22F3NO2 — CID 138971352
ethyl 2-phenyl-3-[4-(trifluoromethyl)anilino]cyclohexene-1-carboxylate (PubChem CID 138971352) has the molecular formula C22H22F3NO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is ethyl 2-phenyl-3-[4-(trifluoromethyl)anilino]cyclohexene-1-carboxylate.
| Compound Name | ethyl 2-phenyl-3-[4-(trifluoromethyl)anilino]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 138971352 |
| Molecular Formula | C22H22F3NO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl 2-phenyl-3-[4-(trifluoromethyl)anilino]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)C(Nc2ccc(C(F)(F)F)cc2)CCC1 |
| InChI | InChI=1S/C22H22F3NO2/c1-2-28-21(27)18-9-6-10-19(20(18)15-7-4-3-5-8-15)26-17-13-11-16(12-14-17)22(23,24)25/h3-5,7-8,11-14,19,26H,2,6,9-10H2,1H3 |
| InChIKey | NFUULQRYAKQOIL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |