C10H14F4O3S2 — CID 138971699
(2-ethoxycarbothioylsulfanyl-4,5,5,5-tetrafluoropentyl) acetate (PubChem CID 138971699) has the molecular formula C10H14F4O3S2 and a molecular weight of 322.35 g/mol. Its IUPAC name is (2-ethoxycarbothioylsulfanyl-4,5,5,5-tetrafluoropentyl) acetate.
| Compound Name | (2-ethoxycarbothioylsulfanyl-4,5,5,5-tetrafluoropentyl) acetate |
|---|---|
| PubChem CID | 138971699 |
| Molecular Formula | C10H14F4O3S2 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | (2-ethoxycarbothioylsulfanyl-4,5,5,5-tetrafluoropentyl) acetate |
| SMILES | CCOC(=S)SC(COC(C)=O)CC(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F4O3S2/c1-3-16-9(18)19-7(5-17-6(2)15)4-8(11)10(12,13)14/h7-8H,3-5H2,1-2H3 |
| InChIKey | GFACWHCWKDXNEM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|