C20H24O5 — CID 138972031
(1S,7S,9R,12S,16S)-2-(hydroxymethyl)-10,10-dimethoxypentacyclo[7.5.3.01,6.07,12.012,16]heptadeca-2,5-diene-11,15-dione (PubChem CID 138972031) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1S,7S,9R,12S,16S)-2-(hydroxymethyl)-10,10-dimethoxypentacyclo[7.5.3.01,6.07,12.012,16]heptadeca-2,5-diene-11,15-dione.
| Compound Name | (1S,7S,9R,12S,16S)-2-(hydroxymethyl)-10,10-dimethoxypentacyclo[7.5.3.01,6.07,12.012,16]heptadeca-2,5-diene-11,15-dione |
|---|---|
| PubChem CID | 138972031 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1S,7S,9R,12S,16S)-2-(hydroxymethyl)-10,10-dimethoxypentacyclo[7.5.3.01,6.07,12.012,16]heptadeca-2,5-diene-11,15-dione |
| SMILES | COC1(OC)C(=O)[C@]23CC[C@]45C(=O)[C@H]2C[C@H]1C[C@H]3C4=CCC=C5CO |
| InChI | InChI=1S/C20H24O5/c1-24-20(25-2)12-8-14-13-5-3-4-11(10-21)18(13)6-7-19(14,17(20)23)15(9-12)16(18)22/h4-5,12,14-15,21H,3,6-10H2,1-2H3/t12-,14+,15-,18-,19+/m1/s1 |
| InChIKey | QTAYBEGLZYFJHD-OUYBGJKKSA-N |
| XLogP | 1.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|